C12H21NO4 — CID 56608344
(2S,3S)-2-[(4-ethoxy-4-oxobutan-2-ylidene)amino]-3-methylpentanoic acid (PubChem CID 56608344) has the molecular formula C12H21NO4 and a molecular weight of 243.30 g/mol. Its IUPAC name is (2S,3S)-2-[(4-ethoxy-4-oxobutan-2-ylidene)amino]-3-methylpentanoic acid.
| Compound Name | (2S,3S)-2-[(4-ethoxy-4-oxobutan-2-ylidene)amino]-3-methylpentanoic acid |
|---|---|
| PubChem CID | 56608344 |
| Molecular Formula | C12H21NO4 |
| Molecular Weight | 243.30 g/mol |
| Exact Mass | 243.15 |
| IUPAC Name | (2S,3S)-2-[(4-ethoxy-4-oxobutan-2-ylidene)amino]-3-methylpentanoic acid |
| SMILES | CCOC(=O)C/C(C)=N/[C@H](C(=O)O)[C@@H](C)CC |
| InChI | InChI=1S/C12H21NO4/c1-5-8(3)11(12(15)16)13-9(4)7-10(14)17-6-2/h8,11H,5-7H2,1-4H3,(H,15,16)/b13-9+/t8-,11-/m0/s1 |
| InChIKey | UKMTWJLEMFDVQR-YMAVLGPOSA-N |
| XLogP | 1.90 |
| TPSA | 75.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.30 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|