C12H11Cl2NO3 — CID 56609109
2-[3-(3,5-dichlorophenyl)prop-2-enoxyamino]prop-2-enoic acid (PubChem CID 56609109) has the molecular formula C12H11Cl2NO3 and a molecular weight of 288.13 g/mol. Its IUPAC name is 2-[3-(3,5-dichlorophenyl)prop-2-enoxyamino]prop-2-enoic acid.
| Compound Name | 2-[3-(3,5-dichlorophenyl)prop-2-enoxyamino]prop-2-enoic acid |
|---|---|
| PubChem CID | 56609109 |
| Molecular Formula | C12H11Cl2NO3 |
| Molecular Weight | 288.13 g/mol |
| Exact Mass | 287.01 |
| IUPAC Name | 2-[3-(3,5-dichlorophenyl)prop-2-enoxyamino]prop-2-enoic acid |
| SMILES | C=C(NOCC=Cc1cc(Cl)cc(Cl)c1)C(=O)O |
| InChI | InChI=1S/C12H11Cl2NO3/c1-8(12(16)17)15-18-4-2-3-9-5-10(13)7-11(14)6-9/h2-3,5-7,15H,1,4H2,(H,16,17) |
| InChIKey | CGNHZVFUYOIQPY-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.13 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|