C12H13ClFNO3 — CID 57066695
2-[3-(3-chlorophenyl)propoxyamino]-3-fluoroprop-2-enoic acid (PubChem CID 57066695) has the molecular formula C12H13ClFNO3 and a molecular weight of 273.69 g/mol. Its IUPAC name is 2-[3-(3-chlorophenyl)propoxyamino]-3-fluoroprop-2-enoic acid.
| Compound Name | 2-[3-(3-chlorophenyl)propoxyamino]-3-fluoroprop-2-enoic acid |
|---|---|
| PubChem CID | 57066695 |
| Molecular Formula | C12H13ClFNO3 |
| Molecular Weight | 273.69 g/mol |
| Exact Mass | 273.06 |
| IUPAC Name | 2-[3-(3-chlorophenyl)propoxyamino]-3-fluoroprop-2-enoic acid |
| SMILES | O=C(O)C(=CF)NOCCCc1cccc(Cl)c1 |
| InChI | InChI=1S/C12H13ClFNO3/c13-10-5-1-3-9(7-10)4-2-6-18-15-11(8-14)12(16)17/h1,3,5,7-8,15H,2,4,6H2,(H,16,17) |
| InChIKey | LUDSLLCWJNKXJS-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.69 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|