C12H14FNO3 — CID 57006862
3-fluoro-2-(3-phenylpropoxyamino)prop-2-enoic acid (PubChem CID 57006862) has the molecular formula C12H14FNO3 and a molecular weight of 239.25 g/mol. Its IUPAC name is 3-fluoro-2-(3-phenylpropoxyamino)prop-2-enoic acid.
| Compound Name | 3-fluoro-2-(3-phenylpropoxyamino)prop-2-enoic acid |
|---|---|
| PubChem CID | 57006862 |
| Molecular Formula | C12H14FNO3 |
| Molecular Weight | 239.25 g/mol |
| Exact Mass | 239.10 |
| IUPAC Name | 3-fluoro-2-(3-phenylpropoxyamino)prop-2-enoic acid |
| SMILES | O=C(O)C(=CF)NOCCCc1ccccc1 |
| InChI | InChI=1S/C12H14FNO3/c13-9-11(12(15)16)14-17-8-4-7-10-5-2-1-3-6-10/h1-3,5-6,9,14H,4,7-8H2,(H,15,16) |
| InChIKey | ORXGXYGJYCWCMB-UHFFFAOYSA-N |
| XLogP | 2.04 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.25 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|