C13H14F3NO3 — CID 57270717
2-[3-[3-(trifluoromethyl)phenyl]propoxyamino]prop-2-enoic acid (PubChem CID 57270717) has the molecular formula C13H14F3NO3 and a molecular weight of 289.25 g/mol. Its IUPAC name is 2-[3-[3-(trifluoromethyl)phenyl]propoxyamino]prop-2-enoic acid.
| Compound Name | 2-[3-[3-(trifluoromethyl)phenyl]propoxyamino]prop-2-enoic acid |
|---|---|
| PubChem CID | 57270717 |
| Molecular Formula | C13H14F3NO3 |
| Molecular Weight | 289.25 g/mol |
| Exact Mass | 289.09 |
| IUPAC Name | 2-[3-[3-(trifluoromethyl)phenyl]propoxyamino]prop-2-enoic acid |
| SMILES | C=C(NOCCCc1cccc(C(F)(F)F)c1)C(=O)O |
| InChI | InChI=1S/C13H14F3NO3/c1-9(12(18)19)17-20-7-3-5-10-4-2-6-11(8-10)13(14,15)16/h2,4,6,8,17H,1,3,5,7H2,(H,18,19) |
| InChIKey | SEFDFPMUWINELE-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.25 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|