C13H15NO3 — CID 56609208
2-[3-(3-methylphenyl)prop-2-enoxyamino]prop-2-enoic acid (PubChem CID 56609208) has the molecular formula C13H15NO3 and a molecular weight of 233.27 g/mol. Its IUPAC name is 2-[3-(3-methylphenyl)prop-2-enoxyamino]prop-2-enoic acid.
| Compound Name | 2-[3-(3-methylphenyl)prop-2-enoxyamino]prop-2-enoic acid |
|---|---|
| PubChem CID | 56609208 |
| Molecular Formula | C13H15NO3 |
| Molecular Weight | 233.27 g/mol |
| Exact Mass | 233.11 |
| IUPAC Name | 2-[3-(3-methylphenyl)prop-2-enoxyamino]prop-2-enoic acid |
| SMILES | C=C(NOCC=Cc1cccc(C)c1)C(=O)O |
| InChI | InChI=1S/C13H15NO3/c1-10-5-3-6-12(9-10)7-4-8-17-14-11(2)13(15)16/h3-7,9,14H,2,8H2,1H3,(H,15,16) |
| InChIKey | JNCXJEPEDYAJIF-UHFFFAOYSA-N |
| XLogP | 2.13 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.27 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|