C11H8F3NO4 — CID 150141740
2-nitro-3-[3-(2,2,2-trifluoroethyl)phenyl]prop-2-enoic acid (PubChem CID 150141740) has the molecular formula C11H8F3NO4 and a molecular weight of 275.18 g/mol. Its IUPAC name is 2-nitro-3-[3-(2,2,2-trifluoroethyl)phenyl]prop-2-enoic acid.
| Compound Name | 2-nitro-3-[3-(2,2,2-trifluoroethyl)phenyl]prop-2-enoic acid |
|---|---|
| PubChem CID | 150141740 |
| Molecular Formula | C11H8F3NO4 |
| Molecular Weight | 275.18 g/mol |
| Exact Mass | 275.04 |
| IUPAC Name | 2-nitro-3-[3-(2,2,2-trifluoroethyl)phenyl]prop-2-enoic acid |
| SMILES | O=C(O)C(=Cc1cccc(CC(F)(F)F)c1)[N+](=O)[O-] |
| InChI | InChI=1S/C11H8F3NO4/c12-11(13,14)6-8-3-1-2-7(4-8)5-9(10(16)17)15(18)19/h1-5H,6H2,(H,16,17) |
| InChIKey | FDKQNNRILRIMFS-UHFFFAOYSA-N |
| XLogP | 2.49 |
| TPSA | 80.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.18 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|