C13H12O5 — CID 566116
(4-methyl-5-oxo-2H-furan-2-yl) 4,6a-dihydro-3aH-cyclopenta[b]furan-3-carboxylate (PubChem CID 566116) has the molecular formula C13H12O5 and a molecular weight of 248.23 g/mol. Its IUPAC name is (4-methyl-5-oxo-2H-furan-2-yl) 4,6a-dihydro-3aH-cyclopenta[b]furan-3-carboxylate.
| Compound Name | (4-methyl-5-oxo-2H-furan-2-yl) 4,6a-dihydro-3aH-cyclopenta[b]furan-3-carboxylate |
|---|---|
| PubChem CID | 566116 |
| Molecular Formula | C13H12O5 |
| Molecular Weight | 248.23 g/mol |
| Exact Mass | 248.07 |
| IUPAC Name | (4-methyl-5-oxo-2H-furan-2-yl) 4,6a-dihydro-3aH-cyclopenta[b]furan-3-carboxylate |
| SMILES | CC1=CC(OC(=O)C2=COC3C=CCC23)OC1=O |
| InChI | InChI=1S/C13H12O5/c1-7-5-11(17-12(7)14)18-13(15)9-6-16-10-4-2-3-8(9)10/h2,4-6,8,10-11H,3H2,1H3 |
| InChIKey | LERSFCZXSJUXBW-UHFFFAOYSA-N |
| XLogP | 1.22 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.23 |
| LogP ≤ 5 | 1.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|