C12H14O5 — CID 134857979
(3E)-4,5-dimethyl-3-[(4-methyl-5-oxo-2H-furan-2-yl)oxymethylidene]oxolan-2-one (PubChem CID 134857979) has the molecular formula C12H14O5 and a molecular weight of 238.24 g/mol. Its IUPAC name is (3E)-4,5-dimethyl-3-[(4-methyl-5-oxo-2H-furan-2-yl)oxymethylidene]oxolan-2-one.
| Compound Name | (3E)-4,5-dimethyl-3-[(4-methyl-5-oxo-2H-furan-2-yl)oxymethylidene]oxolan-2-one |
|---|---|
| PubChem CID | 134857979 |
| Molecular Formula | C12H14O5 |
| Molecular Weight | 238.24 g/mol |
| Exact Mass | 238.08 |
| IUPAC Name | (3E)-4,5-dimethyl-3-[(4-methyl-5-oxo-2H-furan-2-yl)oxymethylidene]oxolan-2-one |
| SMILES | CC1=CC(O/C=C2/C(=O)OC(C)C2C)OC1=O |
| InChI | InChI=1S/C12H14O5/c1-6-4-10(17-11(6)13)15-5-9-7(2)8(3)16-12(9)14/h4-5,7-8,10H,1-3H3/b9-5+ |
| InChIKey | JTEGGRDNBYGZBU-WEVVVXLNSA-N |
| XLogP | 1.30 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.24 |
| LogP ≤ 5 | 1.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|