C42H59F3O4 — CID 56613807
[(2R)-1,1,1-trifluorooctan-2-yl] 1-[4-(4-decylphenyl)cyclohexanecarbonyl]oxy-1,2,3,4-tetrahydronaphthalene-2-carboxylate (PubChem CID 56613807) has the molecular formula C42H59F3O4 and a molecular weight of 684.92 g/mol. Its IUPAC name is [(2R)-1,1,1-trifluorooctan-2-yl] 1-[4-(4-decylphenyl)cyclohexanecarbonyl]oxy-1,2,3,4-tetrahydronaphthalene-2-carboxylate.
| Compound Name | [(2R)-1,1,1-trifluorooctan-2-yl] 1-[4-(4-decylphenyl)cyclohexanecarbonyl]oxy-1,2,3,4-tetrahydronaphthalene-2-carboxylate |
|---|---|
| PubChem CID | 56613807 |
| Molecular Formula | C42H59F3O4 |
| Molecular Weight | 684.92 g/mol |
| Exact Mass | 684.44 |
| IUPAC Name | [(2R)-1,1,1-trifluorooctan-2-yl] 1-[4-(4-decylphenyl)cyclohexanecarbonyl]oxy-1,2,3,4-tetrahydronaphthalene-2-carboxylate |
| SMILES | CCCCCCCCCCc1ccc(C2CCC(C(=O)OC3c4ccccc4CCC3C(=O)O[C@H](CCCCCC)C(F)(F)F)CC2)cc1 |
| InChI | InChI=1S/C42H59F3O4/c1-3-5-7-9-10-11-12-13-17-31-21-23-32(24-22-31)33-25-27-35(28-26-33)40(46)49-39-36-19-16-15-18-34(36)29-30-37(39)41(47)48-38(42(43,44)45)20-14-8-6-4-2/h15-16,18-19,21-24,33,35,37-39H,3-14,17,20,25-30H2,1-2H3/t33?,35?,37?,38-,39?/m1/s1 |
| InChIKey | ZVQWAZOIPRBPTF-IFNIWXMHSA-N |
| XLogP | 11.94 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 684.92 |
| LogP ≤ 5 | 11.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|