C11H12N2O2S — CID 56614961
2-[(2R)-4-oxo-1,3-thiazolidin-2-yl]-N-phenylacetamide (PubChem CID 56614961) has the molecular formula C11H12N2O2S and a molecular weight of 236.30 g/mol. Its IUPAC name is 2-[(2R)-4-oxo-1,3-thiazolidin-2-yl]-N-phenylacetamide.
| Compound Name | 2-[(2R)-4-oxo-1,3-thiazolidin-2-yl]-N-phenylacetamide |
|---|---|
| PubChem CID | 56614961 |
| Molecular Formula | C11H12N2O2S |
| Molecular Weight | 236.30 g/mol |
| Exact Mass | 236.06 |
| IUPAC Name | 2-[(2R)-4-oxo-1,3-thiazolidin-2-yl]-N-phenylacetamide |
| SMILES | O=C(C[C@@H]1NC(=O)CS1)Nc1ccccc1 |
| InChI | InChI=1S/C11H12N2O2S/c14-9(6-11-13-10(15)7-16-11)12-8-4-2-1-3-5-8/h1-5,11H,6-7H2,(H,12,14)(H,13,15)/t11-/m1/s1 |
| InChIKey | TXLAAGNEDNUJLT-LLVKDONJSA-N |
| XLogP | 1.20 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.30 |
| LogP ≤ 5 | 1.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |