C20H26N2 — CID 56615159
6-(cyclopropylmethyl)-4-ethyl-5,11-diazatetracyclo[7.6.1.02,7.012,16]hexadeca-1,4,9(16),11-tetraene (PubChem CID 56615159) has the molecular formula C20H26N2 and a molecular weight of 294.44 g/mol. Its IUPAC name is 6-(cyclopropylmethyl)-4-ethyl-5,11-diazatetracyclo[7.6.1.02,7.012,16]hexadeca-1,4,9(16),11-tetraene.
| Compound Name | 6-(cyclopropylmethyl)-4-ethyl-5,11-diazatetracyclo[7.6.1.02,7.012,16]hexadeca-1,4,9(16),11-tetraene |
|---|---|
| PubChem CID | 56615159 |
| Molecular Formula | C20H26N2 |
| Molecular Weight | 294.44 g/mol |
| Exact Mass | 294.21 |
| IUPAC Name | 6-(cyclopropylmethyl)-4-ethyl-5,11-diazatetracyclo[7.6.1.02,7.012,16]hexadeca-1,4,9(16),11-tetraene |
| SMILES | CCC1=NC(CC2CC2)C2CC3=C4C(=NC3)CCCC4=C2C1 |
| InChI | InChI=1S/C20H26N2/c1-2-14-10-16-15-4-3-5-18-20(15)13(11-21-18)9-17(16)19(22-14)8-12-6-7-12/h12,17,19H,2-11H2,1H3 |
| InChIKey | AKUUUAXZOGRLHD-UHFFFAOYSA-N |
| XLogP | 4.66 |
| TPSA | 24.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.44 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |