C21H30N2 — CID 56620460
6-hexyl-4-methyl-5,11-diazatetracyclo[7.6.1.02,7.012,16]hexadeca-1,4,9(16),11-tetraene (PubChem CID 56620460) has the molecular formula C21H30N2 and a molecular weight of 310.49 g/mol. Its IUPAC name is 6-hexyl-4-methyl-5,11-diazatetracyclo[7.6.1.02,7.012,16]hexadeca-1,4,9(16),11-tetraene.
| Compound Name | 6-hexyl-4-methyl-5,11-diazatetracyclo[7.6.1.02,7.012,16]hexadeca-1,4,9(16),11-tetraene |
|---|---|
| PubChem CID | 56620460 |
| Molecular Formula | C21H30N2 |
| Molecular Weight | 310.49 g/mol |
| Exact Mass | 310.24 |
| IUPAC Name | 6-hexyl-4-methyl-5,11-diazatetracyclo[7.6.1.02,7.012,16]hexadeca-1,4,9(16),11-tetraene |
| SMILES | CCCCCCC1N=C(C)CC2=C3CCCC4=NCC(=C43)CC21 |
| InChI | InChI=1S/C21H30N2/c1-3-4-5-6-9-19-18-12-15-13-22-20-10-7-8-16(21(15)20)17(18)11-14(2)23-19/h18-19H,3-13H2,1-2H3 |
| InChIKey | KXYQJDSQIJFWKG-UHFFFAOYSA-N |
| XLogP | 5.44 |
| TPSA | 24.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.49 |
| LogP ≤ 5 | 5.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|