C25H31N3O4 — CID 56615869
benzyl N-[1-(6-amino-6-oxohexyl)-3-benzyl-2-oxopyrrolidin-3-yl]carbamate (PubChem CID 56615869) has the molecular formula C25H31N3O4 and a molecular weight of 437.54 g/mol. Its IUPAC name is benzyl N-[1-(6-amino-6-oxohexyl)-3-benzyl-2-oxopyrrolidin-3-yl]carbamate.
| Compound Name | benzyl N-[1-(6-amino-6-oxohexyl)-3-benzyl-2-oxopyrrolidin-3-yl]carbamate |
|---|---|
| PubChem CID | 56615869 |
| Molecular Formula | C25H31N3O4 |
| Molecular Weight | 437.54 g/mol |
| Exact Mass | 437.23 |
| IUPAC Name | benzyl N-[1-(6-amino-6-oxohexyl)-3-benzyl-2-oxopyrrolidin-3-yl]carbamate |
| SMILES | NC(=O)CCCCCN1CCC(Cc2ccccc2)(NC(=O)OCc2ccccc2)C1=O |
| InChI | InChI=1S/C25H31N3O4/c26-22(29)14-8-3-9-16-28-17-15-25(23(28)30,18-20-10-4-1-5-11-20)27-24(31)32-19-21-12-6-2-7-13-21/h1-2,4-7,10-13H,3,8-9,14-19H2,(H2,26,29)(H,27,31) |
| InChIKey | YCSOABPHOXOPPB-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 101.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.54 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|