C12H15N — CID 56616023
3,3a,4,6a,9,9b-hexahydro-2H-benzo[de]quinoline (PubChem CID 56616023) has the molecular formula C12H15N and a molecular weight of 173.26 g/mol. Its IUPAC name is 3,3a,4,6a,9,9b-hexahydro-2H-benzo[de]quinoline.
| Compound Name | 3,3a,4,6a,9,9b-hexahydro-2H-benzo[de]quinoline |
|---|---|
| PubChem CID | 56616023 |
| Molecular Formula | C12H15N |
| Molecular Weight | 173.26 g/mol |
| Exact Mass | 173.12 |
| IUPAC Name | 3,3a,4,6a,9,9b-hexahydro-2H-benzo[de]quinoline |
| SMILES | C1=CC2C=CCC3CCN=C(C1)C23 |
| InChI | InChI=1S/C12H15N/c1-3-9-5-2-6-11-12(9)10(4-1)7-8-13-11/h1-3,5,9-10,12H,4,6-8H2 |
| InChIKey | XPEYSZHBOCVVKF-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 173.26 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|