C10H17NO4 — CID 56616875
1-(2,2-diethoxyethyl)pyrrole-2,5-diol (PubChem CID 56616875) has the molecular formula C10H17NO4 and a molecular weight of 215.25 g/mol. Its IUPAC name is 1-(2,2-diethoxyethyl)pyrrole-2,5-diol.
| Compound Name | 1-(2,2-diethoxyethyl)pyrrole-2,5-diol |
|---|---|
| PubChem CID | 56616875 |
| Molecular Formula | C10H17NO4 |
| Molecular Weight | 215.25 g/mol |
| Exact Mass | 215.12 |
| IUPAC Name | 1-(2,2-diethoxyethyl)pyrrole-2,5-diol |
| SMILES | CCOC(Cn1c(O)ccc1O)OCC |
| InChI | InChI=1S/C10H17NO4/c1-3-14-10(15-4-2)7-11-8(12)5-6-9(11)13/h5-6,10,12-13H,3-4,7H2,1-2H3 |
| InChIKey | AMWDBVRVYAIGPX-UHFFFAOYSA-N |
| XLogP | 1.30 |
| TPSA | 63.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 215.25 |
| LogP ≤ 5 | 1.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|