C13H22N2O2 — CID 56619230
2-[(3-cyclohexyl-2-methylprop-2-enyl)diazenyl]propanoic acid (PubChem CID 56619230) has the molecular formula C13H22N2O2 and a molecular weight of 238.33 g/mol. Its IUPAC name is 2-[(3-cyclohexyl-2-methylprop-2-enyl)diazenyl]propanoic acid.
| Compound Name | 2-[(3-cyclohexyl-2-methylprop-2-enyl)diazenyl]propanoic acid |
|---|---|
| PubChem CID | 56619230 |
| Molecular Formula | C13H22N2O2 |
| Molecular Weight | 238.33 g/mol |
| Exact Mass | 238.17 |
| IUPAC Name | 2-[(3-cyclohexyl-2-methylprop-2-enyl)diazenyl]propanoic acid |
| SMILES | CC(=CC1CCCCC1)C/N=N/C(C)C(=O)O |
| InChI | InChI=1S/C13H22N2O2/c1-10(8-12-6-4-3-5-7-12)9-14-15-11(2)13(16)17/h8,11-12H,3-7,9H2,1-2H3,(H,16,17)/b10-8?,15-14+ |
| InChIKey | YXVWQRMZKVICQE-KJPSGJCNSA-N |
| XLogP | 3.44 |
| TPSA | 62.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.33 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|