About [(2,3-dimethyl-5-oxo-1H-pyrazol-4-yl)-methylamino]-phenylmethanesulfonic acid
[(2,3-dimethyl-5-oxo-1H-pyrazol-4-yl)-methylamino]-phenylmethanesulfonic acid (PubChem CID 56619903) has the molecular formula C13H17N3O4S
and a molecular weight of 311.36 g/mol. Its IUPAC name is [(2,3-dimethyl-5-oxo-1H-pyrazol-4-yl)-methylamino]-phenylmethanesulfonic acid.
Molecular Properties
| Compound Name | [(2,3-dimethyl-5-oxo-1H-pyrazol-4-yl)-methylamino]-phenylmethanesulfonic acid |
| PubChem CID | 56619903 |
| Molecular Formula | C13H17N3O4S |
| Molecular Weight | 311.36 g/mol |
| Exact Mass | 311.09 |
| IUPAC Name | [(2,3-dimethyl-5-oxo-1H-pyrazol-4-yl)-methylamino]-phenylmethanesulfonic acid |
| SMILES | Cc1c(N(C)C(c2ccccc2)S(=O)(=O)O)c(=O)[nH]n1C |
| InChI | InChI=1S/C13H17N3O4S/c1-9-11(12(17)14-16(9)3)15(2)13(21(18,19)20)10-7-5-4-6-8-10/h4-8,13H,1-3H3,(H,14,17)(H,18,19,20) |
| InChIKey | GRULFWAYMWLJGC-UHFFFAOYSA-N |
| XLogP | 1.04 |
| TPSA | 95.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 311.36 |
| LogP ≤ 5 | 1.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|
Analyze [(2,3-dimethyl-5-oxo-1H-pyrazol-4-yl)-methylamino]-phenylmethanesulfonic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(2,3-dimethyl-5-oxo-1H-pyrazol-4-yl)-methylamino]-phenylmethanesulfonic acid?
The IUPAC name of [(2,3-dimethyl-5-oxo-1H-pyrazol-4-yl)-methylamino]-phenylmethanesulfonic acid (CID 56619903) is [(2,3-dimethyl-5-oxo-1H-pyrazol-4-yl)-methylamino]-phenylmethanesulfonic acid.
What is the SMILES notation for [(2,3-dimethyl-5-oxo-1H-pyrazol-4-yl)-methylamino]-phenylmethanesulfonic acid?
The canonical SMILES for [(2,3-dimethyl-5-oxo-1H-pyrazol-4-yl)-methylamino]-phenylmethanesulfonic acid is Cc1c(N(C)C(c2ccccc2)S(=O)(=O)O)c(=O)[nH]n1C.
What is the InChIKey of [(2,3-dimethyl-5-oxo-1H-pyrazol-4-yl)-methylamino]-phenylmethanesulfonic acid?
The InChIKey is GRULFWAYMWLJGC-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H17N3O4S/c1-9-11(12(17)14-16(9)3)15(2)13(21(18,19)20)10-7-5-4-6-8-10/h4-8,13H,1-3H3,(H,14,17)(H,18,19,20).
What are the key properties of [(2,3-dimethyl-5-oxo-1H-pyrazol-4-yl)-methylamino]-phenylmethanesulfonic acid?
[(2,3-dimethyl-5-oxo-1H-pyrazol-4-yl)-methylamino]-phenylmethanesulfonic acid has a molecular weight of 311.36 g/mol, XLogP of 1.04, 4 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [(2,3-dimethyl-5-oxo-1H-pyrazol-4-yl)-methylamino]-phenylmethanesulfonic acid is sourced from PubChem (CID 56619903), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).