C11H11N2NaO4S — CID 87143404
sodium 2-(3-oxo-5-phenyl-1H-pyrazol-2-yl)ethanesulfonate (PubChem CID 87143404) has the molecular formula C11H11N2NaO4S and a molecular weight of 290.28 g/mol. Its IUPAC name is sodium 2-(3-oxo-5-phenyl-1H-pyrazol-2-yl)ethanesulfonate.
| Compound Name | sodium 2-(3-oxo-5-phenyl-1H-pyrazol-2-yl)ethanesulfonate |
|---|---|
| PubChem CID | 87143404 |
| Molecular Formula | C11H11N2NaO4S |
| Molecular Weight | 290.28 g/mol |
| Exact Mass | 290.03 |
| IUPAC Name | sodium 2-(3-oxo-5-phenyl-1H-pyrazol-2-yl)ethanesulfonate |
| SMILES | O=c1cc(-c2ccccc2)[nH]n1CCS(=O)(=O)[O-].[Na+] |
| InChI | InChI=1S/C11H12N2O4S.Na/c14-11-8-10(9-4-2-1-3-5-9)12-13(11)6-7-18(15,16)17;/h1-5,8,12H,6-7H2,(H,15,16,17);/q;+1/p-1 |
| InChIKey | QTVSYCGNGBVPFN-UHFFFAOYSA-M |
| XLogP | -2.61 |
| TPSA | 94.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.28 |
| LogP ≤ 5 | -2.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|