About methyl N-pentylidenecarbamate
methyl N-pentylidenecarbamate (PubChem CID 56623768) has the molecular formula C7H13NO2
and a molecular weight of 143.19 g/mol. Its IUPAC name is methyl N-pentylidenecarbamate.
Molecular Properties
| Compound Name | methyl N-pentylidenecarbamate |
| PubChem CID | 56623768 |
| Molecular Formula | C7H13NO2 |
| Molecular Weight | 143.19 g/mol |
| Exact Mass | 143.09 |
| IUPAC Name | methyl N-pentylidenecarbamate |
| SMILES | CCCCC=NC(=O)OC |
| InChI | InChI=1S/C7H13NO2/c1-3-4-5-6-8-7(9)10-2/h6H,3-5H2,1-2H3 |
| InChIKey | LZCXWZPZWITKKL-UHFFFAOYSA-N |
| XLogP | 2.01 |
| TPSA | 38.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 143.19 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze methyl N-pentylidenecarbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl N-pentylidenecarbamate?
The IUPAC name of methyl N-pentylidenecarbamate (CID 56623768) is methyl N-pentylidenecarbamate.
What is the SMILES notation for methyl N-pentylidenecarbamate?
The canonical SMILES for methyl N-pentylidenecarbamate is CCCCC=NC(=O)OC.
What is the InChIKey of methyl N-pentylidenecarbamate?
The InChIKey is LZCXWZPZWITKKL-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H13NO2/c1-3-4-5-6-8-7(9)10-2/h6H,3-5H2,1-2H3.
What are the key properties of methyl N-pentylidenecarbamate?
methyl N-pentylidenecarbamate has a molecular weight of 143.19 g/mol, XLogP of 2.01, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for methyl N-pentylidenecarbamate is sourced from PubChem (CID 56623768), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).