methyl (NZ)-N-ethylidenecarbamate

C4H7NO2 — CID 59960677

IUPACmethyl (NZ)-N-ethylidenecarbamate
SMILESC/C=N\C(=O)OC
InChIInChI=1S/C4H7NO2/c1-3-5-4(6)7-2/h3H,1-2H3/b5-3-
InChIKeyWOPGICRPYPMQMZ-HYXAFXHYSA-N
MW101.10 g/mol
LogP0.84
Rot. Bonds

About methyl (NZ)-N-ethylidenecarbamate

methyl (NZ)-N-ethylidenecarbamate (PubChem CID 59960677) has the molecular formula C4H7NO2 and a molecular weight of 101.10 g/mol. Its IUPAC name is methyl (NZ)-N-ethylidenecarbamate.

Molecular Properties

Compound Namemethyl (NZ)-N-ethylidenecarbamate
PubChem CID59960677
Molecular FormulaC4H7NO2
Molecular Weight101.10 g/mol
Exact Mass101.05
IUPAC Namemethyl (NZ)-N-ethylidenecarbamate
SMILESC/C=N\C(=O)OC
InChIInChI=1S/C4H7NO2/c1-3-5-4(6)7-2/h3H,1-2H3/b5-3-
InChIKeyWOPGICRPYPMQMZ-HYXAFXHYSA-N
XLogP0.84
TPSA38.66 Ų
H-Bond Donors
H-Bond Acceptors2
Rotatable Bonds
Heavy Atoms7
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500101.10
LogP ≤ 50.84
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 102

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'imine_1', 'substructure': 'N/A'}

Analyze methyl (NZ)-N-ethylidenecarbamate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of methyl (NZ)-N-ethylidenecarbamate?
The IUPAC name of methyl (NZ)-N-ethylidenecarbamate (CID 59960677) is methyl (NZ)-N-ethylidenecarbamate.
What is the SMILES notation for methyl (NZ)-N-ethylidenecarbamate?
The canonical SMILES for methyl (NZ)-N-ethylidenecarbamate is C/C=N\C(=O)OC.
What is the InChIKey of methyl (NZ)-N-ethylidenecarbamate?
The InChIKey is WOPGICRPYPMQMZ-HYXAFXHYSA-N. The full InChI is InChI=1S/C4H7NO2/c1-3-5-4(6)7-2/h3H,1-2H3/b5-3-.
What are the key properties of methyl (NZ)-N-ethylidenecarbamate?
methyl (NZ)-N-ethylidenecarbamate has a molecular weight of 101.10 g/mol, XLogP of 0.84, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for methyl (NZ)-N-ethylidenecarbamate is sourced from PubChem (CID 59960677), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).