C18H36 — CID 566241
1,2,3,5-tetra(propan-2-yl)cyclohexane (PubChem CID 566241) has the molecular formula C18H36 and a molecular weight of 252.49 g/mol. Its IUPAC name is 1,2,3,5-tetra(propan-2-yl)cyclohexane.
| Compound Name | 1,2,3,5-tetra(propan-2-yl)cyclohexane |
|---|---|
| PubChem CID | 566241 |
| Molecular Formula | C18H36 |
| Molecular Weight | 252.49 g/mol |
| Exact Mass | 252.28 |
| IUPAC Name | 1,2,3,5-tetra(propan-2-yl)cyclohexane |
| SMILES | CC(C)C1CC(C(C)C)C(C(C)C)C(C(C)C)C1 |
| InChI | InChI=1S/C18H36/c1-11(2)15-9-16(12(3)4)18(14(7)8)17(10-15)13(5)6/h11-18H,9-10H2,1-8H3 |
| InChIKey | OSFCYBJAAQCHFK-UHFFFAOYSA-N |
| XLogP | 5.87 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.49 |
| LogP ≤ 5 | 5.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |