About 3-hydroxy-3-benzazepine
3-hydroxy-3-benzazepine (PubChem CID 56629441) has the molecular formula C10H9NO
and a molecular weight of 159.19 g/mol. Its IUPAC name is 3-hydroxy-3-benzazepine.
Molecular Properties
| Compound Name | 3-hydroxy-3-benzazepine |
| PubChem CID | 56629441 |
| Molecular Formula | C10H9NO |
| Molecular Weight | 159.19 g/mol |
| Exact Mass | 159.07 |
| IUPAC Name | 3-hydroxy-3-benzazepine |
| SMILES | ON1C=Cc2ccccc2C=C1 |
| InChI | InChI=1S/C10H9NO/c12-11-7-5-9-3-1-2-4-10(9)6-8-11/h1-8,12H |
| InChIKey | AUGZQEXRGQZIRD-UHFFFAOYSA-N |
| XLogP | 2.33 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 159.19 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 3-hydroxy-3-benzazepine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-hydroxy-3-benzazepine?
The IUPAC name of 3-hydroxy-3-benzazepine (CID 56629441) is 3-hydroxy-3-benzazepine.
What is the SMILES notation for 3-hydroxy-3-benzazepine?
The canonical SMILES for 3-hydroxy-3-benzazepine is ON1C=Cc2ccccc2C=C1.
What is the InChIKey of 3-hydroxy-3-benzazepine?
The InChIKey is AUGZQEXRGQZIRD-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H9NO/c12-11-7-5-9-3-1-2-4-10(9)6-8-11/h1-8,12H.
What are the key properties of 3-hydroxy-3-benzazepine?
3-hydroxy-3-benzazepine has a molecular weight of 159.19 g/mol, XLogP of 2.33, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-hydroxy-3-benzazepine is sourced from PubChem (CID 56629441), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).