C20H31NO7 — CID 56630867
[2-oxo-1-phenyl-2-(2,2,5,5-tetramethoxyhexylamino)ethyl] acetate (PubChem CID 56630867) has the molecular formula C20H31NO7 and a molecular weight of 397.47 g/mol. Its IUPAC name is [2-oxo-1-phenyl-2-(2,2,5,5-tetramethoxyhexylamino)ethyl] acetate.
| Compound Name | [2-oxo-1-phenyl-2-(2,2,5,5-tetramethoxyhexylamino)ethyl] acetate |
|---|---|
| PubChem CID | 56630867 |
| Molecular Formula | C20H31NO7 |
| Molecular Weight | 397.47 g/mol |
| Exact Mass | 397.21 |
| IUPAC Name | [2-oxo-1-phenyl-2-(2,2,5,5-tetramethoxyhexylamino)ethyl] acetate |
| SMILES | COC(C)(CCC(CNC(=O)C(OC(C)=O)c1ccccc1)(OC)OC)OC |
| InChI | InChI=1S/C20H31NO7/c1-15(22)28-17(16-10-8-7-9-11-16)18(23)21-14-20(26-5,27-6)13-12-19(2,24-3)25-4/h7-11,17H,12-14H2,1-6H3,(H,21,23) |
| InChIKey | YEMXGFJZFKMXLR-UHFFFAOYSA-N |
| XLogP | 2.19 |
| TPSA | 92.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.47 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|