C11H16O8S — CID 56631714
2-[3-(1,2-dicarboxyethylsulfanyl)propyl]butanedioic acid (PubChem CID 56631714) has the molecular formula C11H16O8S and a molecular weight of 308.31 g/mol. Its IUPAC name is 2-[3-(1,2-dicarboxyethylsulfanyl)propyl]butanedioic acid.
| Compound Name | 2-[3-(1,2-dicarboxyethylsulfanyl)propyl]butanedioic acid |
|---|---|
| PubChem CID | 56631714 |
| Molecular Formula | C11H16O8S |
| Molecular Weight | 308.31 g/mol |
| Exact Mass | 308.06 |
| IUPAC Name | 2-[3-(1,2-dicarboxyethylsulfanyl)propyl]butanedioic acid |
| SMILES | O=C(O)CC(CCCSC(CC(=O)O)C(=O)O)C(=O)O |
| InChI | InChI=1S/C11H16O8S/c12-8(13)4-6(10(16)17)2-1-3-20-7(11(18)19)5-9(14)15/h6-7H,1-5H2,(H,12,13)(H,14,15)(H,16,17)(H,18,19) |
| InChIKey | KQGZFYCYGHTYNZ-UHFFFAOYSA-N |
| XLogP | 0.60 |
| TPSA | 149.20 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.31 |
| LogP ≤ 5 | 0.60 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|