C12H22O3S — CID 18723748
2-(1-ethylsulfanyl-1-oxopropan-2-yl)-3,3-dimethylpentanoic acid (PubChem CID 18723748) has the molecular formula C12H22O3S and a molecular weight of 246.37 g/mol. Its IUPAC name is 2-(1-ethylsulfanyl-1-oxopropan-2-yl)-3,3-dimethylpentanoic acid.
| Compound Name | 2-(1-ethylsulfanyl-1-oxopropan-2-yl)-3,3-dimethylpentanoic acid |
|---|---|
| PubChem CID | 18723748 |
| Molecular Formula | C12H22O3S |
| Molecular Weight | 246.37 g/mol |
| Exact Mass | 246.13 |
| IUPAC Name | 2-(1-ethylsulfanyl-1-oxopropan-2-yl)-3,3-dimethylpentanoic acid |
| SMILES | CCSC(=O)C(C)C(C(=O)O)C(C)(C)CC |
| InChI | InChI=1S/C12H22O3S/c1-6-12(4,5)9(10(13)14)8(3)11(15)16-7-2/h8-9H,6-7H2,1-5H3,(H,13,14) |
| InChIKey | NUSVKPBXOLPUPW-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.37 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|