C16H30F2O2S — CID 151659442
2-tert-butyl-2-(6,6-difluorohexylsulfanyl)-4-methylpentanoic acid (PubChem CID 151659442) has the molecular formula C16H30F2O2S and a molecular weight of 324.48 g/mol. Its IUPAC name is 2-tert-butyl-2-(6,6-difluorohexylsulfanyl)-4-methylpentanoic acid.
| Compound Name | 2-tert-butyl-2-(6,6-difluorohexylsulfanyl)-4-methylpentanoic acid |
|---|---|
| PubChem CID | 151659442 |
| Molecular Formula | C16H30F2O2S |
| Molecular Weight | 324.48 g/mol |
| Exact Mass | 324.19 |
| IUPAC Name | 2-tert-butyl-2-(6,6-difluorohexylsulfanyl)-4-methylpentanoic acid |
| SMILES | CC(C)CC(SCCCCCC(F)F)(C(=O)O)C(C)(C)C |
| InChI | InChI=1S/C16H30F2O2S/c1-12(2)11-16(14(19)20,15(3,4)5)21-10-8-6-7-9-13(17)18/h12-13H,6-11H2,1-5H3,(H,19,20) |
| InChIKey | QWFKNWMCVQKZIN-UHFFFAOYSA-N |
| XLogP | 5.46 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.48 |
| LogP ≤ 5 | 5.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|