C15H27F3O2S — CID 151758911
4-methyl-2-propan-2-yl-2-(6,6,6-trifluorohexylsulfanyl)pentanoic acid (PubChem CID 151758911) has the molecular formula C15H27F3O2S and a molecular weight of 328.44 g/mol. Its IUPAC name is 4-methyl-2-propan-2-yl-2-(6,6,6-trifluorohexylsulfanyl)pentanoic acid.
| Compound Name | 4-methyl-2-propan-2-yl-2-(6,6,6-trifluorohexylsulfanyl)pentanoic acid |
|---|---|
| PubChem CID | 151758911 |
| Molecular Formula | C15H27F3O2S |
| Molecular Weight | 328.44 g/mol |
| Exact Mass | 328.17 |
| IUPAC Name | 4-methyl-2-propan-2-yl-2-(6,6,6-trifluorohexylsulfanyl)pentanoic acid |
| SMILES | CC(C)CC(SCCCCCC(F)(F)F)(C(=O)O)C(C)C |
| InChI | InChI=1S/C15H27F3O2S/c1-11(2)10-14(12(3)4,13(19)20)21-9-7-5-6-8-15(16,17)18/h11-12H,5-10H2,1-4H3,(H,19,20) |
| InChIKey | RQDGWUIMIQRCSN-UHFFFAOYSA-N |
| XLogP | 5.37 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.44 |
| LogP ≤ 5 | 5.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|