C21H26N4O6S2 — CID 56631839
(4R,6S)-3-(N-ethoxy-C-morpholin-4-ylcarbonimidoyl)-4-methyl-8-oxo-7-[(2-thiophen-2-ylacetyl)amino]-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid (PubChem CID 56631839) has the molecular formula C21H26N4O6S2 and a molecular weight of 494.60 g/mol. Its IUPAC name is (4R,6S)-3-(N-ethoxy-C-morpholin-4-ylcarbonimidoyl)-4-methyl-8-oxo-7-[(2-thiophen-2-ylacetyl)amino]-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid.
| Compound Name | (4R,6S)-3-(N-ethoxy-C-morpholin-4-ylcarbonimidoyl)-4-methyl-8-oxo-7-[(2-thiophen-2-ylacetyl)amino]-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid |
|---|---|
| PubChem CID | 56631839 |
| Molecular Formula | C21H26N4O6S2 |
| Molecular Weight | 494.60 g/mol |
| Exact Mass | 494.13 |
| IUPAC Name | (4R,6S)-3-(N-ethoxy-C-morpholin-4-ylcarbonimidoyl)-4-methyl-8-oxo-7-[(2-thiophen-2-ylacetyl)amino]-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid |
| SMILES | CCON=C(C1=C(C(=O)O)N2C(=O)C(NC(=O)Cc3cccs3)[C@@H]2S[C@@H]1C)N1CCOCC1 |
| InChI | InChI=1S/C21H26N4O6S2/c1-3-31-23-18(24-6-8-30-9-7-24)15-12(2)33-20-16(19(27)25(20)17(15)21(28)29)22-14(26)11-13-5-4-10-32-13/h4-5,10,12,16,20H,3,6-9,11H2,1-2H3,(H,22,26)(H,28,29)/t12-,16?,20+/m1/s1 |
| InChIKey | ZVGHVLYERDWFBR-BSNVRXNXSA-N |
| XLogP | 1.10 |
| TPSA | 120.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.60 |
| LogP ≤ 5 | 1.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|