C34H36N4O6S2 — CID 88716183
benzhydryl (4R,6R)-4-methyl-3-[(E)-1-morpholin-4-ylethoxyiminomethyl]-8-oxo-7-[(2-thiophen-2-ylacetyl)amino]-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylate (PubChem CID 88716183) has the molecular formula C34H36N4O6S2 and a molecular weight of 660.82 g/mol. Its IUPAC name is benzhydryl (4R,6R)-4-methyl-3-[(E)-1-morpholin-4-ylethoxyiminomethyl]-8-oxo-7-[(2-thiophen-2-ylacetyl)amino]-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylate.
| Compound Name | benzhydryl (4R,6R)-4-methyl-3-[(E)-1-morpholin-4-ylethoxyiminomethyl]-8-oxo-7-[(2-thiophen-2-ylacetyl)amino]-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylate |
|---|---|
| PubChem CID | 88716183 |
| Molecular Formula | C34H36N4O6S2 |
| Molecular Weight | 660.82 g/mol |
| Exact Mass | 660.21 |
| IUPAC Name | benzhydryl (4R,6R)-4-methyl-3-[(E)-1-morpholin-4-ylethoxyiminomethyl]-8-oxo-7-[(2-thiophen-2-ylacetyl)amino]-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylate |
| SMILES | CC(O/N=C/C1=C(C(=O)OC(c2ccccc2)c2ccccc2)N2C(=O)C(NC(=O)Cc3cccs3)[C@H]2S[C@@H]1C)N1CCOCC1 |
| InChI | InChI=1S/C34H36N4O6S2/c1-22-27(21-35-44-23(2)37-15-17-42-18-16-37)30(34(41)43-31(24-10-5-3-6-11-24)25-12-7-4-8-13-25)38-32(40)29(33(38)46-22)36-28(39)20-26-14-9-19-45-26/h3-14,19,21-23,29,31,33H,15-18,20H2,1-2H3,(H,36,39)/b35-21+/t22-,23?,29?,33-/m1/s1 |
| InChIKey | DLBFHGZUYBYDMV-RHVUZHENSA-N |
| XLogP | 4.35 |
| TPSA | 109.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 46 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 660.82 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|