C19H7F17O4S — CID 56631970
2-(1,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9,9-heptadecafluoronon-1-enoxy)naphthalene-1-sulfonic acid (PubChem CID 56631970) has the molecular formula C19H7F17O4S and a molecular weight of 654.29 g/mol. Its IUPAC name is 2-(1,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9,9-heptadecafluoronon-1-enoxy)naphthalene-1-sulfonic acid.
| Compound Name | 2-(1,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9,9-heptadecafluoronon-1-enoxy)naphthalene-1-sulfonic acid |
|---|---|
| PubChem CID | 56631970 |
| Molecular Formula | C19H7F17O4S |
| Molecular Weight | 654.29 g/mol |
| Exact Mass | 653.98 |
| IUPAC Name | 2-(1,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9,9-heptadecafluoronon-1-enoxy)naphthalene-1-sulfonic acid |
| SMILES | O=S(=O)(O)c1c(OC(F)=C(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F)ccc2ccccc12 |
| InChI | InChI=1S/C19H7F17O4S/c20-11(12(21)40-9-6-5-7-3-1-2-4-8(7)10(9)41(37,38)39)13(22,23)14(24,25)15(26,27)16(28,29)17(30,31)18(32,33)19(34,35)36/h1-6H,(H,37,38,39) |
| InChIKey | WTSPEJHAXVJEKJ-UHFFFAOYSA-N |
| XLogP | 7.95 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 654.29 |
| LogP ≤ 5 | 7.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|