C16H9F5O5S2 — CID 18739182
[5-[4-(2,2-difluoroethenyl)-3-fluorosulfonylphenyl]-2-(1-fluoroethenoxy)phenyl]sulfanyloxy hypofluorite (PubChem CID 18739182) has the molecular formula C16H9F5O5S2 and a molecular weight of 440.37 g/mol. Its IUPAC name is [5-[4-(2,2-difluoroethenyl)-3-fluorosulfonylphenyl]-2-(1-fluoroethenoxy)phenyl]sulfanyloxy hypofluorite.
| Compound Name | [5-[4-(2,2-difluoroethenyl)-3-fluorosulfonylphenyl]-2-(1-fluoroethenoxy)phenyl]sulfanyloxy hypofluorite |
|---|---|
| PubChem CID | 18739182 |
| Molecular Formula | C16H9F5O5S2 |
| Molecular Weight | 440.37 g/mol |
| Exact Mass | 439.98 |
| IUPAC Name | [5-[4-(2,2-difluoroethenyl)-3-fluorosulfonylphenyl]-2-(1-fluoroethenoxy)phenyl]sulfanyloxy hypofluorite |
| SMILES | C=C(F)Oc1ccc(-c2ccc(C=C(F)F)c(S(=O)(=O)F)c2)cc1SOOF |
| InChI | InChI=1S/C16H9F5O5S2/c1-9(17)24-13-5-4-10(6-14(13)27-26-25-20)11-2-3-12(8-16(18)19)15(7-11)28(21,22)23/h2-8H,1H2 |
| InChIKey | DVJTXTPZQPJXGU-UHFFFAOYSA-N |
| XLogP | 5.91 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.37 |
| LogP ≤ 5 | 5.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'}, {'alert_name': 'sulfur_oxygen_single_bond', 'substructure': 'N/A'} |
|---|