C15H9F4NO5S — CID 57297883
2-(difluoromethoxy)-3-[4-(difluoromethoxy)phenyl]-N-(oxomethylidene)benzenesulfonamide (PubChem CID 57297883) has the molecular formula C15H9F4NO5S and a molecular weight of 391.30 g/mol. Its IUPAC name is 2-(difluoromethoxy)-3-[4-(difluoromethoxy)phenyl]-N-(oxomethylidene)benzenesulfonamide.
| Compound Name | 2-(difluoromethoxy)-3-[4-(difluoromethoxy)phenyl]-N-(oxomethylidene)benzenesulfonamide |
|---|---|
| PubChem CID | 57297883 |
| Molecular Formula | C15H9F4NO5S |
| Molecular Weight | 391.30 g/mol |
| Exact Mass | 391.01 |
| IUPAC Name | 2-(difluoromethoxy)-3-[4-(difluoromethoxy)phenyl]-N-(oxomethylidene)benzenesulfonamide |
| SMILES | O=C=NS(=O)(=O)c1cccc(-c2ccc(OC(F)F)cc2)c1OC(F)F |
| InChI | InChI=1S/C15H9F4NO5S/c16-14(17)24-10-6-4-9(5-7-10)11-2-1-3-12(13(11)25-15(18)19)26(22,23)20-8-21/h1-7,14-15H |
| InChIKey | MZBFABVFTANUBT-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 82.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.30 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isocyanate', 'substructure': 'N/A'} |
|---|