C6H11FO2 — CID 56635196
(2R,3S)-3-fluorohex-5-ene-1,2-diol (PubChem CID 56635196) has the molecular formula C6H11FO2 and a molecular weight of 134.15 g/mol. Its IUPAC name is (2R,3S)-3-fluorohex-5-ene-1,2-diol.
| Compound Name | (2R,3S)-3-fluorohex-5-ene-1,2-diol |
|---|---|
| PubChem CID | 56635196 |
| Molecular Formula | C6H11FO2 |
| Molecular Weight | 134.15 g/mol |
| Exact Mass | 134.07 |
| IUPAC Name | (2R,3S)-3-fluorohex-5-ene-1,2-diol |
| SMILES | C=CC[C@H](F)[C@H](O)CO |
| InChI | InChI=1S/C6H11FO2/c1-2-3-5(7)6(9)4-8/h2,5-6,8-9H,1,3-4H2/t5-,6+/m0/s1 |
| InChIKey | YKWRHUCOBHHZJR-NTSWFWBYSA-N |
| XLogP | 0.25 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 134.15 |
| LogP ≤ 5 | 0.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|