C11H17NO4 — CID 56636525
2-[(1R,2R)-2-methylcyclohexyl]oxyimino-3-oxobutanoic acid (PubChem CID 56636525) has the molecular formula C11H17NO4 and a molecular weight of 227.26 g/mol. Its IUPAC name is 2-[(1R,2R)-2-methylcyclohexyl]oxyimino-3-oxobutanoic acid.
| Compound Name | 2-[(1R,2R)-2-methylcyclohexyl]oxyimino-3-oxobutanoic acid |
|---|---|
| PubChem CID | 56636525 |
| Molecular Formula | C11H17NO4 |
| Molecular Weight | 227.26 g/mol |
| Exact Mass | 227.12 |
| IUPAC Name | 2-[(1R,2R)-2-methylcyclohexyl]oxyimino-3-oxobutanoic acid |
| SMILES | CC(=O)C(=NO[C@@H]1CCCC[C@H]1C)C(=O)O |
| InChI | InChI=1S/C11H17NO4/c1-7-5-3-4-6-9(7)16-12-10(8(2)13)11(14)15/h7,9H,3-6H2,1-2H3,(H,14,15)/t7-,9-/m1/s1 |
| InChIKey | XRODRWIFUSAGGV-VXNVDRBHSA-N |
| XLogP | 1.61 |
| TPSA | 75.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.26 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|