C40H80N6O2 — CID 56637126
1,1-di(butan-2-yl)-3-[2-[di(butan-2-yl)carbamoyl-(1,2,2,6,6-pentamethylpiperidin-4-yl)amino]ethyl]-3-(1,2,2,6,6-pentamethylpiperidin-4-yl)urea (PubChem CID 56637126) has the molecular formula C40H80N6O2 and a molecular weight of 677.12 g/mol. Its IUPAC name is 1,1-di(butan-2-yl)-3-[2-[di(butan-2-yl)carbamoyl-(1,2,2,6,6-pentamethylpiperidin-4-yl)amino]ethyl]-3-(1,2,2,6,6-pentamethylpiperidin-4-yl)urea.
| Compound Name | 1,1-di(butan-2-yl)-3-[2-[di(butan-2-yl)carbamoyl-(1,2,2,6,6-pentamethylpiperidin-4-yl)amino]ethyl]-3-(1,2,2,6,6-pentamethylpiperidin-4-yl)urea |
|---|---|
| PubChem CID | 56637126 |
| Molecular Formula | C40H80N6O2 |
| Molecular Weight | 677.12 g/mol |
| Exact Mass | 676.63 |
| IUPAC Name | 1,1-di(butan-2-yl)-3-[2-[di(butan-2-yl)carbamoyl-(1,2,2,6,6-pentamethylpiperidin-4-yl)amino]ethyl]-3-(1,2,2,6,6-pentamethylpiperidin-4-yl)urea |
| SMILES | CCC(C)N(C(=O)N(CCN(C(=O)N(C(C)CC)C(C)CC)C1CC(C)(C)N(C)C(C)(C)C1)C1CC(C)(C)N(C)C(C)(C)C1)C(C)CC |
| InChI | InChI=1S/C40H80N6O2/c1-19-29(5)45(30(6)20-2)35(47)43(33-25-37(9,10)41(17)38(11,12)26-33)23-24-44(36(48)46(31(7)21-3)32(8)22-4)34-27-39(13,14)42(18)40(15,16)28-34/h29-34H,19-28H2,1-18H3 |
| InChIKey | LYHCAMGTIKYSFJ-UHFFFAOYSA-N |
| XLogP | 8.93 |
| TPSA | 53.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 677.12 |
| LogP ≤ 5 | 8.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |