C21H42N4O — CID 19790580
1,3-bis(1,2,2,6,6-pentamethylpiperidin-4-yl)urea (PubChem CID 19790580) has the molecular formula C21H42N4O and a molecular weight of 366.59 g/mol. Its IUPAC name is 1,3-bis(1,2,2,6,6-pentamethylpiperidin-4-yl)urea.
| Compound Name | 1,3-bis(1,2,2,6,6-pentamethylpiperidin-4-yl)urea |
|---|---|
| PubChem CID | 19790580 |
| Molecular Formula | C21H42N4O |
| Molecular Weight | 366.59 g/mol |
| Exact Mass | 366.34 |
| IUPAC Name | 1,3-bis(1,2,2,6,6-pentamethylpiperidin-4-yl)urea |
| SMILES | CN1C(C)(C)CC(NC(=O)NC2CC(C)(C)N(C)C(C)(C)C2)CC1(C)C |
| InChI | InChI=1S/C21H42N4O/c1-18(2)11-15(12-19(3,4)24(18)9)22-17(26)23-16-13-20(5,6)25(10)21(7,8)14-16/h15-16H,11-14H2,1-10H3,(H2,22,23,26) |
| InChIKey | WGCIWQQFBWXFGG-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 47.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.59 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |