C22H42N4O — CID 1309454
1,3-bis(2,2,6,6-tetramethylpiperidin-4-yl)-1,3-diazinan-4-one (PubChem CID 1309454) has the molecular formula C22H42N4O and a molecular weight of 378.61 g/mol. Its IUPAC name is 1,3-bis(2,2,6,6-tetramethylpiperidin-4-yl)-1,3-diazinan-4-one.
| Compound Name | 1,3-bis(2,2,6,6-tetramethylpiperidin-4-yl)-1,3-diazinan-4-one |
|---|---|
| PubChem CID | 1309454 |
| Molecular Formula | C22H42N4O |
| Molecular Weight | 378.61 g/mol |
| Exact Mass | 378.34 |
| IUPAC Name | 1,3-bis(2,2,6,6-tetramethylpiperidin-4-yl)-1,3-diazinan-4-one |
| SMILES | CC1(C)CC(N2CCC(=O)N(C3CC(C)(C)NC(C)(C)C3)C2)CC(C)(C)N1 |
| InChI | InChI=1S/C22H42N4O/c1-19(2)11-16(12-20(3,4)23-19)25-10-9-18(27)26(15-25)17-13-21(5,6)24-22(7,8)14-17/h16-17,23-24H,9-15H2,1-8H3 |
| InChIKey | HXYMPEFUVKOMEX-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 47.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.61 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |