C23H46N4O — CID 22966879
N-(1,2,2,6,6-pentamethylpiperidin-4-yl)-3-[(1,2,2,6,6-pentamethylpiperidin-4-yl)amino]propanamide (PubChem CID 22966879) has the molecular formula C23H46N4O and a molecular weight of 394.65 g/mol. Its IUPAC name is N-(1,2,2,6,6-pentamethylpiperidin-4-yl)-3-[(1,2,2,6,6-pentamethylpiperidin-4-yl)amino]propanamide.
| Compound Name | N-(1,2,2,6,6-pentamethylpiperidin-4-yl)-3-[(1,2,2,6,6-pentamethylpiperidin-4-yl)amino]propanamide |
|---|---|
| PubChem CID | 22966879 |
| Molecular Formula | C23H46N4O |
| Molecular Weight | 394.65 g/mol |
| Exact Mass | 394.37 |
| IUPAC Name | N-(1,2,2,6,6-pentamethylpiperidin-4-yl)-3-[(1,2,2,6,6-pentamethylpiperidin-4-yl)amino]propanamide |
| SMILES | CN1C(C)(C)CC(NCCC(=O)NC2CC(C)(C)N(C)C(C)(C)C2)CC1(C)C |
| InChI | InChI=1S/C23H46N4O/c1-20(2)13-17(14-21(3,4)26(20)9)24-12-11-19(28)25-18-15-22(5,6)27(10)23(7,8)16-18/h17-18,24H,11-16H2,1-10H3,(H,25,28) |
| InChIKey | HLZNQYCNXIPLMR-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 47.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.65 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |