C24H46N4O — CID 23451952
1,3-bis(1,2,2,6,6-pentamethylpiperidin-4-yl)-1,3-diazinan-2-one (PubChem CID 23451952) has the molecular formula C24H46N4O and a molecular weight of 406.66 g/mol. Its IUPAC name is 1,3-bis(1,2,2,6,6-pentamethylpiperidin-4-yl)-1,3-diazinan-2-one.
| Compound Name | 1,3-bis(1,2,2,6,6-pentamethylpiperidin-4-yl)-1,3-diazinan-2-one |
|---|---|
| PubChem CID | 23451952 |
| Molecular Formula | C24H46N4O |
| Molecular Weight | 406.66 g/mol |
| Exact Mass | 406.37 |
| IUPAC Name | 1,3-bis(1,2,2,6,6-pentamethylpiperidin-4-yl)-1,3-diazinan-2-one |
| SMILES | CN1C(C)(C)CC(N2CCCN(C3CC(C)(C)N(C)C(C)(C)C3)C2=O)CC1(C)C |
| InChI | InChI=1S/C24H46N4O/c1-21(2)14-18(15-22(3,4)25(21)9)27-12-11-13-28(20(27)29)19-16-23(5,6)26(10)24(7,8)17-19/h18-19H,11-17H2,1-10H3 |
| InChIKey | OCDQBKNEOLOYQJ-UHFFFAOYSA-N |
| XLogP | 4.42 |
| TPSA | 30.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.66 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |