C25H28O4 — CID 56638056
[(8R,9S,10R,13S,14S,15S)-13-methyl-3,17-dioxo-1,2,6,7,8,9,10,11,12,14,15,16-dodecahydrocyclopenta[a]phenanthren-15-yl] benzoate (PubChem CID 56638056) has the molecular formula C25H28O4 and a molecular weight of 392.50 g/mol. Its IUPAC name is [(8R,9S,10R,13S,14S,15S)-13-methyl-3,17-dioxo-1,2,6,7,8,9,10,11,12,14,15,16-dodecahydrocyclopenta[a]phenanthren-15-yl] benzoate.
| Compound Name | [(8R,9S,10R,13S,14S,15S)-13-methyl-3,17-dioxo-1,2,6,7,8,9,10,11,12,14,15,16-dodecahydrocyclopenta[a]phenanthren-15-yl] benzoate |
|---|---|
| PubChem CID | 56638056 |
| Molecular Formula | C25H28O4 |
| Molecular Weight | 392.50 g/mol |
| Exact Mass | 392.20 |
| IUPAC Name | [(8R,9S,10R,13S,14S,15S)-13-methyl-3,17-dioxo-1,2,6,7,8,9,10,11,12,14,15,16-dodecahydrocyclopenta[a]phenanthren-15-yl] benzoate |
| SMILES | C[C@]12CC[C@H]3[C@@H](CCC4=CC(=O)CC[C@@H]43)[C@@H]1[C@@H](OC(=O)c1ccccc1)CC2=O |
| InChI | InChI=1S/C25H28O4/c1-25-12-11-19-18-10-8-17(26)13-16(18)7-9-20(19)23(25)21(14-22(25)27)29-24(28)15-5-3-2-4-6-15/h2-6,13,18-21,23H,7-12,14H2,1H3/t18-,19+,20+,21-,23+,25+/m0/s1 |
| InChIKey | JZKOSPORWBXPMZ-YLVOLFGNSA-N |
| XLogP | 4.53 |
| TPSA | 60.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.50 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |