C15H19NO4S — CID 56641345
tert-butyl (6R,7E)-3-methyl-8-oxo-7-(1-oxopropan-2-ylidene)-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylate (PubChem CID 56641345) has the molecular formula C15H19NO4S and a molecular weight of 309.39 g/mol. Its IUPAC name is tert-butyl (6R,7E)-3-methyl-8-oxo-7-(1-oxopropan-2-ylidene)-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylate.
| Compound Name | tert-butyl (6R,7E)-3-methyl-8-oxo-7-(1-oxopropan-2-ylidene)-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylate |
|---|---|
| PubChem CID | 56641345 |
| Molecular Formula | C15H19NO4S |
| Molecular Weight | 309.39 g/mol |
| Exact Mass | 309.10 |
| IUPAC Name | tert-butyl (6R,7E)-3-methyl-8-oxo-7-(1-oxopropan-2-ylidene)-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylate |
| SMILES | CC1=C(C(=O)OC(C)(C)C)N2C(=O)/C(=C(/C)C=O)[C@H]2SC1 |
| InChI | InChI=1S/C15H19NO4S/c1-8(6-17)10-12(18)16-11(9(2)7-21-13(10)16)14(19)20-15(3,4)5/h6,13H,7H2,1-5H3/b10-8+/t13-/m1/s1 |
| InChIKey | DIFRRISEMRHKDW-AORWBKJGSA-N |
| XLogP | 2.03 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.39 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|