C13H17N3O5S — CID 70463539
(6S,7Z)-3-methyl-7-[(2-methylpropan-2-yl)oxycarbonylhydrazinylidene]-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid (PubChem CID 70463539) has the molecular formula C13H17N3O5S and a molecular weight of 327.36 g/mol. Its IUPAC name is (6S,7Z)-3-methyl-7-[(2-methylpropan-2-yl)oxycarbonylhydrazinylidene]-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid.
| Compound Name | (6S,7Z)-3-methyl-7-[(2-methylpropan-2-yl)oxycarbonylhydrazinylidene]-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid |
|---|---|
| PubChem CID | 70463539 |
| Molecular Formula | C13H17N3O5S |
| Molecular Weight | 327.36 g/mol |
| Exact Mass | 327.09 |
| IUPAC Name | (6S,7Z)-3-methyl-7-[(2-methylpropan-2-yl)oxycarbonylhydrazinylidene]-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid |
| SMILES | CC1=C(C(=O)O)N2C(=O)/C(=N/NC(=O)OC(C)(C)C)[C@@H]2SC1 |
| InChI | InChI=1S/C13H17N3O5S/c1-6-5-22-10-7(9(17)16(10)8(6)11(18)19)14-15-12(20)21-13(2,3)4/h10H,5H2,1-4H3,(H,15,20)(H,18,19)/b14-7-/t10-/m0/s1 |
| InChIKey | JNCYTGOTIZNLLE-IXIHQHOXSA-N |
| XLogP | 1.14 |
| TPSA | 108.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.36 |
| LogP ≤ 5 | 1.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|