C17H12F3N5 — CID 56642607
5-[2-[1-methyl-5-[4-(trifluoromethyl)phenyl]pyrazol-4-yl]ethynyl]pyrimidin-2-amine (PubChem CID 56642607) has the molecular formula C17H12F3N5 and a molecular weight of 343.31 g/mol. Its IUPAC name is 5-[2-[1-methyl-5-[4-(trifluoromethyl)phenyl]pyrazol-4-yl]ethynyl]pyrimidin-2-amine.
| Compound Name | 5-[2-[1-methyl-5-[4-(trifluoromethyl)phenyl]pyrazol-4-yl]ethynyl]pyrimidin-2-amine |
|---|---|
| PubChem CID | 56642607 |
| Molecular Formula | C17H12F3N5 |
| Molecular Weight | 343.31 g/mol |
| Exact Mass | 343.10 |
| IUPAC Name | 5-[2-[1-methyl-5-[4-(trifluoromethyl)phenyl]pyrazol-4-yl]ethynyl]pyrimidin-2-amine |
| SMILES | Cn1ncc(C#Cc2cnc(N)nc2)c1-c1ccc(C(F)(F)F)cc1 |
| InChI | InChI=1S/C17H12F3N5/c1-25-15(12-4-6-14(7-5-12)17(18,19)20)13(10-24-25)3-2-11-8-22-16(21)23-9-11/h4-10H,1H3,(H2,21,22,23) |
| InChIKey | CNAWQQDCASENIY-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 69.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.31 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|