C21H28ClN3O3 — CID 56642746
ethyl 4-[4-(5-chloro-2-oxo-3H-indol-1-yl)piperidin-1-yl]piperidine-1-carboxylate (PubChem CID 56642746) has the molecular formula C21H28ClN3O3 and a molecular weight of 405.93 g/mol. Its IUPAC name is ethyl 4-[4-(5-chloro-2-oxo-3H-indol-1-yl)piperidin-1-yl]piperidine-1-carboxylate.
| Compound Name | ethyl 4-[4-(5-chloro-2-oxo-3H-indol-1-yl)piperidin-1-yl]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 56642746 |
| Molecular Formula | C21H28ClN3O3 |
| Molecular Weight | 405.93 g/mol |
| Exact Mass | 405.18 |
| IUPAC Name | ethyl 4-[4-(5-chloro-2-oxo-3H-indol-1-yl)piperidin-1-yl]piperidine-1-carboxylate |
| SMILES | CCOC(=O)N1CCC(N2CCC(N3C(=O)Cc4cc(Cl)ccc43)CC2)CC1 |
| InChI | InChI=1S/C21H28ClN3O3/c1-2-28-21(27)24-11-5-17(6-12-24)23-9-7-18(8-10-23)25-19-4-3-16(22)13-15(19)14-20(25)26/h3-4,13,17-18H,2,5-12,14H2,1H3 |
| InChIKey | GCNIMONEBOEEKK-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 53.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.93 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |