C19H16Cl2F3N3O2 — CID 56645447
N'-[3-[5-(3,5-dichlorophenyl)-5-(trifluoromethyl)-4H-1,2-oxazol-3-yl]phenyl]-N'-methylacetohydrazide (PubChem CID 56645447) has the molecular formula C19H16Cl2F3N3O2 and a molecular weight of 446.26 g/mol. Its IUPAC name is N'-[3-[5-(3,5-dichlorophenyl)-5-(trifluoromethyl)-4H-1,2-oxazol-3-yl]phenyl]-N'-methylacetohydrazide.
| Compound Name | N'-[3-[5-(3,5-dichlorophenyl)-5-(trifluoromethyl)-4H-1,2-oxazol-3-yl]phenyl]-N'-methylacetohydrazide |
|---|---|
| PubChem CID | 56645447 |
| Molecular Formula | C19H16Cl2F3N3O2 |
| Molecular Weight | 446.26 g/mol |
| Exact Mass | 445.06 |
| IUPAC Name | N'-[3-[5-(3,5-dichlorophenyl)-5-(trifluoromethyl)-4H-1,2-oxazol-3-yl]phenyl]-N'-methylacetohydrazide |
| SMILES | CC(=O)NN(C)c1cccc(C2=NOC(c3cc(Cl)cc(Cl)c3)(C(F)(F)F)C2)c1 |
| InChI | InChI=1S/C19H16Cl2F3N3O2/c1-11(28)25-27(2)16-5-3-4-12(6-16)17-10-18(29-26-17,19(22,23)24)13-7-14(20)9-15(21)8-13/h3-9H,10H2,1-2H3,(H,25,28) |
| InChIKey | VHNHIXFUFIQGKI-UHFFFAOYSA-N |
| XLogP | 5.06 |
| TPSA | 53.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.26 |
| LogP ≤ 5 | 5.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|