C8H10O4 — CID 56646951
methyl (2R)-2-hydroxy-2-[(1R)-4-oxocyclopent-2-en-1-yl]acetate (PubChem CID 56646951) has the molecular formula C8H10O4 and a molecular weight of 170.16 g/mol. Its IUPAC name is methyl (2R)-2-hydroxy-2-[(1R)-4-oxocyclopent-2-en-1-yl]acetate.
| Compound Name | methyl (2R)-2-hydroxy-2-[(1R)-4-oxocyclopent-2-en-1-yl]acetate |
|---|---|
| PubChem CID | 56646951 |
| Molecular Formula | C8H10O4 |
| Molecular Weight | 170.16 g/mol |
| Exact Mass | 170.06 |
| IUPAC Name | methyl (2R)-2-hydroxy-2-[(1R)-4-oxocyclopent-2-en-1-yl]acetate |
| SMILES | COC(=O)[C@H](O)[C@H]1C=CC(=O)C1 |
| InChI | InChI=1S/C8H10O4/c1-12-8(11)7(10)5-2-3-6(9)4-5/h2-3,5,7,10H,4H2,1H3/t5-,7+/m0/s1 |
| InChIKey | QOJQVEJDUXQGNF-CAHLUQPWSA-N |
| XLogP | -0.33 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 170.16 |
| LogP ≤ 5 | -0.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |