C13H20O4 — CID 162951494
(4R,5S)-5-[(E,5R)-5-hydroxy-4-oxooct-2-enyl]-4-methyloxolan-2-one (PubChem CID 162951494) has the molecular formula C13H20O4 and a molecular weight of 240.30 g/mol. Its IUPAC name is (4R,5S)-5-[(E,5R)-5-hydroxy-4-oxooct-2-enyl]-4-methyloxolan-2-one.
| Compound Name | (4R,5S)-5-[(E,5R)-5-hydroxy-4-oxooct-2-enyl]-4-methyloxolan-2-one |
|---|---|
| PubChem CID | 162951494 |
| Molecular Formula | C13H20O4 |
| Molecular Weight | 240.30 g/mol |
| Exact Mass | 240.14 |
| IUPAC Name | (4R,5S)-5-[(E,5R)-5-hydroxy-4-oxooct-2-enyl]-4-methyloxolan-2-one |
| SMILES | CCC[C@@H](O)C(=O)/C=C/C[C@@H]1OC(=O)C[C@H]1C |
| InChI | InChI=1S/C13H20O4/c1-3-5-10(14)11(15)6-4-7-12-9(2)8-13(16)17-12/h4,6,9-10,12,14H,3,5,7-8H2,1-2H3/b6-4+/t9-,10-,12+/m1/s1 |
| InChIKey | AQBDNVSAYLLLQP-YCAYXCTESA-N |
| XLogP | 1.61 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.30 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|