C52H31BF8N2O — CID 56647249
2,2-difluoro-4,5,6,10,11,12-hexakis(4-fluorophenyl)-8-(4-methoxyphenyl)-3-aza-1-azonia-2-boranuidatricyclo[7.3.0.03,7]dodeca-1(12),4,6,8,10-pentaene (PubChem CID 56647249) has the molecular formula C52H31BF8N2O and a molecular weight of 862.63 g/mol. Its IUPAC name is 2,2-difluoro-4,5,6,10,11,12-hexakis(4-fluorophenyl)-8-(4-methoxyphenyl)-3-aza-1-azonia-2-boranuidatricyclo[7.3.0.03,7]dodeca-1(12),4,6,8,10-pentaene.
| Compound Name | 2,2-difluoro-4,5,6,10,11,12-hexakis(4-fluorophenyl)-8-(4-methoxyphenyl)-3-aza-1-azonia-2-boranuidatricyclo[7.3.0.03,7]dodeca-1(12),4,6,8,10-pentaene |
|---|---|
| PubChem CID | 56647249 |
| Molecular Formula | C52H31BF8N2O |
| Molecular Weight | 862.63 g/mol |
| Exact Mass | 862.24 |
| IUPAC Name | 2,2-difluoro-4,5,6,10,11,12-hexakis(4-fluorophenyl)-8-(4-methoxyphenyl)-3-aza-1-azonia-2-boranuidatricyclo[7.3.0.03,7]dodeca-1(12),4,6,8,10-pentaene |
| SMILES | COc1ccc(C2=C3C(c4ccc(F)cc4)=C(c4ccc(F)cc4)C(c4ccc(F)cc4)=[N+]3[B-](F)(F)n3c2c(-c2ccc(F)cc2)c(-c2ccc(F)cc2)c3-c2ccc(F)cc2)cc1 |
| InChI | InChI=1S/C52H31BF8N2O/c1-64-43-28-14-34(15-29-43)48-51-46(32-6-20-39(56)21-7-32)44(30-2-16-37(54)17-3-30)49(35-10-24-41(58)25-11-35)62(51)53(60,61)63-50(36-12-26-42(59)27-13-36)45(31-4-18-38(55)19-5-31)47(52(48)63)33-8-22-40(57)23-9-33/h2-29H,1H3 |
| InChIKey | HVGWIONKEZRGNF-UHFFFAOYSA-N |
| XLogP | 13.45 |
| TPSA | 17.17 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 64 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 862.63 |
| LogP ≤ 5 | 13.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|