C23H24F3N3O4S — CID 56651000
(1,1-dioxo-1,4-thiazinan-4-yl)-[3-[3-(trifluoromethoxy)anilino]-4-azatricyclo[6.2.2.02,7]dodeca-2(7),3,5-trien-6-yl]methanone (PubChem CID 56651000) has the molecular formula C23H24F3N3O4S and a molecular weight of 495.52 g/mol. Its IUPAC name is (1,1-dioxo-1,4-thiazinan-4-yl)-[3-[3-(trifluoromethoxy)anilino]-4-azatricyclo[6.2.2.02,7]dodeca-2(7),3,5-trien-6-yl]methanone.
| Compound Name | (1,1-dioxo-1,4-thiazinan-4-yl)-[3-[3-(trifluoromethoxy)anilino]-4-azatricyclo[6.2.2.02,7]dodeca-2(7),3,5-trien-6-yl]methanone |
|---|---|
| PubChem CID | 56651000 |
| Molecular Formula | C23H24F3N3O4S |
| Molecular Weight | 495.52 g/mol |
| Exact Mass | 495.14 |
| IUPAC Name | (1,1-dioxo-1,4-thiazinan-4-yl)-[3-[3-(trifluoromethoxy)anilino]-4-azatricyclo[6.2.2.02,7]dodeca-2(7),3,5-trien-6-yl]methanone |
| SMILES | O=C(c1cnc(Nc2cccc(OC(F)(F)F)c2)c2c1C1CCC2CC1)N1CCS(=O)(=O)CC1 |
| InChI | InChI=1S/C23H24F3N3O4S/c24-23(25,26)33-17-3-1-2-16(12-17)28-21-20-15-6-4-14(5-7-15)19(20)18(13-27-21)22(30)29-8-10-34(31,32)11-9-29/h1-3,12-15H,4-11H2,(H,27,28) |
| InChIKey | BYGGJQFYQCQJEI-UHFFFAOYSA-N |
| XLogP | 4.35 |
| TPSA | 88.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.52 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |